C29H28BF3N8O2 — CID 157391783
7-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-[1,2,4]triazolo[1,5-a]pyridine;7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 157391783) has the molecular formula C29H28BF3N8O2 and a molecular weight of 588.40 g/mol. Its IUPAC name is 7-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-[1,2,4]triazolo[1,5-a]pyridine;7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 7-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-[1,2,4]triazolo[1,5-a]pyridine;7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 157391783 |
| Molecular Formula | C29H28BF3N8O2 |
| Molecular Weight | 588.40 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | 7-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-[1,2,4]triazolo[1,5-a]pyridine;7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CC1(C)OB(c2ccn3ncnc3c2)OC1(C)C.Fc1ccc(-c2ncn(CC(F)F)c2-c2ccn3ncnc3c2)cc1 |
| InChI | InChI=1S/C17H12F3N5.C12H16BN3O2/c18-13-3-1-11(2-4-13)16-17(24(10-22-16)8-14(19)20)12-5-6-25-15(7-12)21-9-23-25;1-11(2)12(3,4)18-13(17-11)9-5-6-16-10(7-9)14-8-15-16/h1-7,9-10,14H,8H2;5-8H,1-4H3 |
| InChIKey | BMBZNWRBWJIUMR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 96.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|