C27H32N4O — CID 157392846
3-(1H-benzimidazol-2-yl)-1-[1-[(5-methyl-1H-indol-3-yl)methyl]piperidin-4-yl]pentan-1-one (PubChem CID 157392846) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-1-[1-[(5-methyl-1H-indol-3-yl)methyl]piperidin-4-yl]pentan-1-one.
| Compound Name | 3-(1H-benzimidazol-2-yl)-1-[1-[(5-methyl-1H-indol-3-yl)methyl]piperidin-4-yl]pentan-1-one |
|---|---|
| PubChem CID | 157392846 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-1-[1-[(5-methyl-1H-indol-3-yl)methyl]piperidin-4-yl]pentan-1-one |
| SMILES | CCC(CC(=O)C1CCN(Cc2c[nH]c3ccc(C)cc23)CC1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C27H32N4O/c1-3-19(27-29-24-6-4-5-7-25(24)30-27)15-26(32)20-10-12-31(13-11-20)17-21-16-28-23-9-8-18(2)14-22(21)23/h4-9,14,16,19-20,28H,3,10-13,15,17H2,1-2H3,(H,29,30) |
| InChIKey | CNOSXFKZXPFJDB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |