C33H35N5O3S — CID 157393421
3-[4-[(2R)-1,4-dimethyl-3-oxopiperazin-2-yl]anilino]-1-methyl-5-[3-[2-oxo-2-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethyl]phenyl]pyrazin-2-one (PubChem CID 157393421) has the molecular formula C33H35N5O3S and a molecular weight of 581.74 g/mol. Its IUPAC name is 3-[4-[(2R)-1,4-dimethyl-3-oxopiperazin-2-yl]anilino]-1-methyl-5-[3-[2-oxo-2-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethyl]phenyl]pyrazin-2-one.
| Compound Name | 3-[4-[(2R)-1,4-dimethyl-3-oxopiperazin-2-yl]anilino]-1-methyl-5-[3-[2-oxo-2-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethyl]phenyl]pyrazin-2-one |
|---|---|
| PubChem CID | 157393421 |
| Molecular Formula | C33H35N5O3S |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | 3-[4-[(2R)-1,4-dimethyl-3-oxopiperazin-2-yl]anilino]-1-methyl-5-[3-[2-oxo-2-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethyl]phenyl]pyrazin-2-one |
| SMILES | CN1CCN(C)[C@H](c2ccc(Nc3nc(-c4cccc(CC(=O)c5cc6c(s5)CCCC6)c4)cn(C)c3=O)cc2)C1=O |
| InChI | InChI=1S/C33H35N5O3S/c1-36-15-16-37(2)32(40)30(36)22-11-13-25(14-12-22)34-31-33(41)38(3)20-26(35-31)23-9-6-7-21(17-23)18-27(39)29-19-24-8-4-5-10-28(24)42-29/h6-7,9,11-14,17,19-20,30H,4-5,8,10,15-16,18H2,1-3H3,(H,34,35)/t30-/m1/s1 |
| InChIKey | FBTAXNPESGPQTH-SSEXGKCCSA-N |
| XLogP | 5.00 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |