C37H40F8O2 — CID 157393835
1-tert-butyl-2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[4-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]phenoxy]phenyl]benzene;ethane (PubChem CID 157393835) has the molecular formula C37H40F8O2 and a molecular weight of 668.71 g/mol. Its IUPAC name is 1-tert-butyl-2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[4-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]phenoxy]phenyl]benzene;ethane.
| Compound Name | 1-tert-butyl-2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[4-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]phenoxy]phenyl]benzene;ethane |
|---|---|
| PubChem CID | 157393835 |
| Molecular Formula | C37H40F8O2 |
| Molecular Weight | 668.71 g/mol |
| Exact Mass | 668.29 |
| IUPAC Name | 1-tert-butyl-2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[4-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]phenoxy]phenyl]benzene;ethane |
| SMILES | CC.CC.CC(C)(C)Oc1ccc(Cc2ccc(Oc3c(F)c(F)c(-c4c(F)c(F)c(C(C)(C)C)c(F)c4F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C33H28F8O2.2C2H6/c1-32(2,3)22-27(38)23(34)20(24(35)28(22)39)21-25(36)29(40)31(30(41)26(21)37)42-18-11-7-16(8-12-18)15-17-9-13-19(14-10-17)43-33(4,5)6;2*1-2/h7-14H,15H2,1-6H3;2*1-2H3 |
| InChIKey | BMIIZECNBUHKCY-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.71 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|