About ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate
ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate (PubChem CID 15739396) has the molecular formula C15H16ClFN2O4
and a molecular weight of 342.75 g/mol. Its IUPAC name is ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate |
| PubChem CID | 15739396 |
| Molecular Formula | C15H16ClFN2O4 |
| Molecular Weight | 342.75 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)C1CN(C2CC2)c2nc(Cl)c(F)c(CO)c2C1=O |
| InChI | InChI=1S/C15H16ClFN2O4/c1-2-23-15(22)8-5-19(7-3-4-7)14-10(12(8)21)9(6-20)11(17)13(16)18-14/h7-8,20H,2-6H2,1H3 |
| InChIKey | BCMNNBXUFJYREN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.75 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate?
The IUPAC name of ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate (CID 15739396) is ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate.
What is the SMILES notation for ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate?
The canonical SMILES for ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate is CCOC(=O)C1CN(C2CC2)c2nc(Cl)c(F)c(CO)c2C1=O.
What is the InChIKey of ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate?
The InChIKey is BCMNNBXUFJYREN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClFN2O4/c1-2-23-15(22)8-5-19(7-3-4-7)14-10(12(8)21)9(6-20)11(17)13(16)18-14/h7-8,20H,2-6H2,1H3.
What are the key properties of ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate?
ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate has a molecular weight of 342.75 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-chloro-1-cyclopropyl-6-fluoro-5-(hydroxymethyl)-4-oxo-2,3-dihydro-1,8-naphthyridine-3-carboxylate is sourced from PubChem (CID 15739396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).