About 1H-indene;thieno[3,2-b]thiophene
1H-indene;thieno[3,2-b]thiophene (PubChem CID 157394053) has the molecular formula C15H12S2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 1H-indene;thieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 1H-indene;thieno[3,2-b]thiophene |
| PubChem CID | 157394053 |
| Molecular Formula | C15H12S2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 1H-indene;thieno[3,2-b]thiophene |
| SMILES | C1=Cc2ccccc2C1.c1cc2sccc2s1 |
| InChI | InChI=1S/C9H8.C6H4S2/c1-2-5-9-7-3-6-8(9)4-1;1-3-7-6-2-4-8-5(1)6/h1-6H,7H2;1-4H |
| InChIKey | BMIYMOIGGBSWFC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indene;thieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indene;thieno[3,2-b]thiophene?
The IUPAC name of 1H-indene;thieno[3,2-b]thiophene (CID 157394053) is 1H-indene;thieno[3,2-b]thiophene.
What is the SMILES notation for 1H-indene;thieno[3,2-b]thiophene?
The canonical SMILES for 1H-indene;thieno[3,2-b]thiophene is C1=Cc2ccccc2C1.c1cc2sccc2s1.
What is the InChIKey of 1H-indene;thieno[3,2-b]thiophene?
The InChIKey is BMIYMOIGGBSWFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.C6H4S2/c1-2-5-9-7-3-6-8(9)4-1;1-3-7-6-2-4-8-5(1)6/h1-6H,7H2;1-4H.
What are the key properties of 1H-indene;thieno[3,2-b]thiophene?
1H-indene;thieno[3,2-b]thiophene has a molecular weight of 256.39 g/mol, XLogP of 5.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indene;thieno[3,2-b]thiophene is sourced from PubChem (CID 157394053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).