sodium dihydroxy-oxido-trihydroxysilyloxysilane

H5NaO7Si2 — CID 157396705

IUPACsodium dihydroxy-oxido-trihydroxysilyloxysilane
SMILES[Na+].[O-][Si](O)(O)O[Si](O)(O)O
InChIInChI=1S/Na.H5O7Si2/c;1-8(2,3)7-9(4,5)6/h;1-5H/q+1;-1
InChIKeyBMQPYVHLTGTHFX-UHFFFAOYSA-N
MW196.19 g/mol
LogP-7.80
Rot. Bonds2

About sodium dihydroxy-oxido-trihydroxysilyloxysilane

sodium dihydroxy-oxido-trihydroxysilyloxysilane (PubChem CID 157396705) has the molecular formula H5NaO7Si2 and a molecular weight of 196.19 g/mol. Its IUPAC name is sodium dihydroxy-oxido-trihydroxysilyloxysilane.

Molecular Properties

Compound Namesodium dihydroxy-oxido-trihydroxysilyloxysilane
PubChem CID157396705
Molecular FormulaH5NaO7Si2
Molecular Weight196.19 g/mol
Exact Mass195.95
IUPAC Namesodium dihydroxy-oxido-trihydroxysilyloxysilane
SMILES[Na+].[O-][Si](O)(O)O[Si](O)(O)O
InChIInChI=1S/Na.H5O7Si2/c;1-8(2,3)7-9(4,5)6/h;1-5H/q+1;-1
InChIKeyBMQPYVHLTGTHFX-UHFFFAOYSA-N
XLogP-7.80
TPSA133.44 Ų
H-Bond Donors5
H-Bond Acceptors7
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.19
LogP ≤ 5-7.80
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze sodium dihydroxy-oxido-trihydroxysilyloxysilane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium dihydroxy-oxido-trihydroxysilyloxysilane?
The IUPAC name of sodium dihydroxy-oxido-trihydroxysilyloxysilane (CID 157396705) is sodium dihydroxy-oxido-trihydroxysilyloxysilane.
What is the SMILES notation for sodium dihydroxy-oxido-trihydroxysilyloxysilane?
The canonical SMILES for sodium dihydroxy-oxido-trihydroxysilyloxysilane is [Na+].[O-][Si](O)(O)O[Si](O)(O)O.
What is the InChIKey of sodium dihydroxy-oxido-trihydroxysilyloxysilane?
The InChIKey is BMQPYVHLTGTHFX-UHFFFAOYSA-N. The full InChI is InChI=1S/Na.H5O7Si2/c;1-8(2,3)7-9(4,5)6/h;1-5H/q+1;-1.
What are the key properties of sodium dihydroxy-oxido-trihydroxysilyloxysilane?
sodium dihydroxy-oxido-trihydroxysilyloxysilane has a molecular weight of 196.19 g/mol, XLogP of -7.80, 2 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium dihydroxy-oxido-trihydroxysilyloxysilane is sourced from PubChem (CID 157396705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).