C53H24N4O8S — CID 157397092
(4-nitrophenyl)-[4-(4-nitrophenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]methanone;tritriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecayne (PubChem CID 157397092) has the molecular formula C53H24N4O8S and a molecular weight of 876.86 g/mol. Its IUPAC name is (4-nitrophenyl)-[4-(4-nitrophenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]methanone;tritriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecayne.
| Compound Name | (4-nitrophenyl)-[4-(4-nitrophenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]methanone;tritriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecayne |
|---|---|
| PubChem CID | 157397092 |
| Molecular Formula | C53H24N4O8S |
| Molecular Weight | 876.86 g/mol |
| Exact Mass | 876.13 |
| IUPAC Name | (4-nitrophenyl)-[4-(4-nitrophenyl)sulfonyl-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]methanone;tritriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecayne |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC.O=C(c1ccc([N+](=O)[O-])cc1)N1CCC2(CC1)OCCN2S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H4.C20H20N4O8S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;25-19(15-1-3-16(4-2-15)23(26)27)21-11-9-20(10-12-21)22(13-14-32-20)33(30,31)18-7-5-17(6-8-18)24(28)29/h1H,2H3;1-8H,9-14H2 |
| InChIKey | BMRTUORIXREQAY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 66 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.86 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|