C16H21BFNO2 — CID 157397914
1-ethyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 157397914) has the molecular formula C16H21BFNO2 and a molecular weight of 289.16 g/mol. Its IUPAC name is 1-ethyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 1-ethyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 157397914 |
| Molecular Formula | C16H21BFNO2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-ethyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | CCn1ccc2c(B3OC(C)(C)C(C)(C)O3)cc(F)cc21 |
| InChI | InChI=1S/C16H21BFNO2/c1-6-19-8-7-12-13(9-11(18)10-14(12)19)17-20-15(2,3)16(4,5)21-17/h7-10H,6H2,1-5H3 |
| InChIKey | UFFAYZGEVKQDJM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|