About 4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide
4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide (PubChem CID 157398278) has the molecular formula C18H21FN2O3
and a molecular weight of 332.38 g/mol. Its IUPAC name is 4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide.
Molecular Properties
| Compound Name | 4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide |
| PubChem CID | 157398278 |
| Molecular Formula | C18H21FN2O3 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide |
| SMILES | CCC(=O)CCCc1c(C(=O)NC)[nH]c2cc(F)c3c(c12)CCO3 |
| InChI | InChI=1S/C18H21FN2O3/c1-3-10(22)5-4-6-11-15-12-7-8-24-17(12)13(19)9-14(15)21-16(11)18(23)20-2/h9,21H,3-8H2,1-2H3,(H,20,23) |
| InChIKey | BMVLTJQXONDXPV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide?
The IUPAC name of 4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide (CID 157398278) is 4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide.
What is the SMILES notation for 4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide?
The canonical SMILES for 4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide is CCC(=O)CCCc1c(C(=O)NC)[nH]c2cc(F)c3c(c12)CCO3.
What is the InChIKey of 4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide?
The InChIKey is BMVLTJQXONDXPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21FN2O3/c1-3-10(22)5-4-6-11-15-12-7-8-24-17(12)13(19)9-14(15)21-16(11)18(23)20-2/h9,21H,3-8H2,1-2H3,(H,20,23).
What are the key properties of 4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide?
4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide has a molecular weight of 332.38 g/mol, XLogP of 2.90, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-methyl-8-(4-oxohexyl)-2,6-dihydro-1H-furo[3,2-e]indole-7-carboxamide is sourced from PubChem (CID 157398278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).