C22H24F18O5 — CID 157399059
5-hydroxypent-1-en-3-one;3,3,4,4,5,5,6,6,6-nonafluorohexan-1-ol;5-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pent-1-en-3-one (PubChem CID 157399059) has the molecular formula C22H24F18O5 and a molecular weight of 710.39 g/mol. Its IUPAC name is 5-hydroxypent-1-en-3-one;3,3,4,4,5,5,6,6,6-nonafluorohexan-1-ol;5-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pent-1-en-3-one.
| Compound Name | 5-hydroxypent-1-en-3-one;3,3,4,4,5,5,6,6,6-nonafluorohexan-1-ol;5-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pent-1-en-3-one |
|---|---|
| PubChem CID | 157399059 |
| Molecular Formula | C22H24F18O5 |
| Molecular Weight | 710.39 g/mol |
| Exact Mass | 710.13 |
| IUPAC Name | 5-hydroxypent-1-en-3-one;3,3,4,4,5,5,6,6,6-nonafluorohexan-1-ol;5-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pent-1-en-3-one |
| SMILES | C=CC(=O)CCO.C=CC(=O)CCOCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F9O2.C6H5F9O.C5H8O2/c1-2-7(21)3-5-22-6-4-8(12,13)9(14,15)10(16,17)11(18,19)20;7-3(8,1-2-16)4(9,10)5(11,12)6(13,14)15;1-2-5(7)3-4-6/h2H,1,3-6H2;16H,1-2H2;2,6H,1,3-4H2 |
| InChIKey | BMXRWVGCBOCODI-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.39 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|