C40H32Br2F4N2O4 — CID 157399253
ethyl 1,5-bis(4-fluorophenyl)-2-methylpyrrole-3-carboxylate;ethyl 4-bromo-2-(bromomethyl)-1,5-bis(4-fluorophenyl)pyrrole-3-carboxylate (PubChem CID 157399253) has the molecular formula C40H32Br2F4N2O4 and a molecular weight of 840.51 g/mol. Its IUPAC name is ethyl 1,5-bis(4-fluorophenyl)-2-methylpyrrole-3-carboxylate;ethyl 4-bromo-2-(bromomethyl)-1,5-bis(4-fluorophenyl)pyrrole-3-carboxylate.
| Compound Name | ethyl 1,5-bis(4-fluorophenyl)-2-methylpyrrole-3-carboxylate;ethyl 4-bromo-2-(bromomethyl)-1,5-bis(4-fluorophenyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 157399253 |
| Molecular Formula | C40H32Br2F4N2O4 |
| Molecular Weight | 840.51 g/mol |
| Exact Mass | 838.07 |
| IUPAC Name | ethyl 1,5-bis(4-fluorophenyl)-2-methylpyrrole-3-carboxylate;ethyl 4-bromo-2-(bromomethyl)-1,5-bis(4-fluorophenyl)pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(Br)c(-c2ccc(F)cc2)n(-c2ccc(F)cc2)c1CBr.CCOC(=O)c1cc(-c2ccc(F)cc2)n(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C20H15Br2F2NO2.C20H17F2NO2/c1-2-27-20(26)17-16(11-21)25(15-9-7-14(24)8-10-15)19(18(17)22)12-3-5-13(23)6-4-12;1-3-25-20(24)18-12-19(14-4-6-15(21)7-5-14)23(13(18)2)17-10-8-16(22)9-11-17/h3-10H,2,11H2,1H3;4-12H,3H2,1-2H3 |
| InChIKey | BMYFZKMDTQGCNN-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.51 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|