C15H15N — CID 157399359
6-(4-ethynylphenyl)-3-methyl-2-methylidene-3,4-dihydro-1H-pyridine (PubChem CID 157399359) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is 6-(4-ethynylphenyl)-3-methyl-2-methylidene-3,4-dihydro-1H-pyridine.
| Compound Name | 6-(4-ethynylphenyl)-3-methyl-2-methylidene-3,4-dihydro-1H-pyridine |
|---|---|
| PubChem CID | 157399359 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 6-(4-ethynylphenyl)-3-methyl-2-methylidene-3,4-dihydro-1H-pyridine |
| SMILES | C#Cc1ccc(C2=CCC(C)C(=C)N2)cc1 |
| InChI | InChI=1S/C15H15N/c1-4-13-6-8-14(9-7-13)15-10-5-11(2)12(3)16-15/h1,6-11,16H,3,5H2,2H3 |
| InChIKey | BTNDQOCRODLTOU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|