About 1-[(2-methylpropan-2-yl)oxy]decane;oxolane
1-[(2-methylpropan-2-yl)oxy]decane;oxolane (PubChem CID 157399947) has the molecular formula C18H38O2
and a molecular weight of 286.50 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxy]decane;oxolane.
Molecular Properties
| Compound Name | 1-[(2-methylpropan-2-yl)oxy]decane;oxolane |
| PubChem CID | 157399947 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxy]decane;oxolane |
| SMILES | C1CCOC1.CCCCCCCCCCOC(C)(C)C |
| InChI | InChI=1S/C14H30O.C4H8O/c1-5-6-7-8-9-10-11-12-13-15-14(2,3)4;1-2-4-5-3-1/h5-13H2,1-4H3;1-4H2 |
| InChIKey | BNALJJHUEVTGCS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-methylpropan-2-yl)oxy]decane;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methylpropan-2-yl)oxy]decane;oxolane?
The IUPAC name of 1-[(2-methylpropan-2-yl)oxy]decane;oxolane (CID 157399947) is 1-[(2-methylpropan-2-yl)oxy]decane;oxolane.
What is the SMILES notation for 1-[(2-methylpropan-2-yl)oxy]decane;oxolane?
The canonical SMILES for 1-[(2-methylpropan-2-yl)oxy]decane;oxolane is C1CCOC1.CCCCCCCCCCOC(C)(C)C.
What is the InChIKey of 1-[(2-methylpropan-2-yl)oxy]decane;oxolane?
The InChIKey is BNALJJHUEVTGCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O.C4H8O/c1-5-6-7-8-9-10-11-12-13-15-14(2,3)4;1-2-4-5-3-1/h5-13H2,1-4H3;1-4H2.
What are the key properties of 1-[(2-methylpropan-2-yl)oxy]decane;oxolane?
1-[(2-methylpropan-2-yl)oxy]decane;oxolane has a molecular weight of 286.50 g/mol, XLogP of 5.74, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methylpropan-2-yl)oxy]decane;oxolane is sourced from PubChem (CID 157399947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).