C35H42N2O10 — CID 157400755
[(2R,3R,4R,5R,6R)-3,4-diacetyloxy-6-[(E)-4-[4-[[2-hydroxyethyl(1H-indol-3-ylmethyl)amino]methyl]phenyl]-2-oxobut-3-enoxy]-5-methyloxan-2-yl]methyl acetate (PubChem CID 157400755) has the molecular formula C35H42N2O10 and a molecular weight of 650.73 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-6-[(E)-4-[4-[[2-hydroxyethyl(1H-indol-3-ylmethyl)amino]methyl]phenyl]-2-oxobut-3-enoxy]-5-methyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-6-[(E)-4-[4-[[2-hydroxyethyl(1H-indol-3-ylmethyl)amino]methyl]phenyl]-2-oxobut-3-enoxy]-5-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 157400755 |
| Molecular Formula | C35H42N2O10 |
| Molecular Weight | 650.73 g/mol |
| Exact Mass | 650.28 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-6-[(E)-4-[4-[[2-hydroxyethyl(1H-indol-3-ylmethyl)amino]methyl]phenyl]-2-oxobut-3-enoxy]-5-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCC(=O)/C=C/c2ccc(CN(CCO)Cc3c[nH]c4ccccc34)cc2)[C@H](C)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C35H42N2O10/c1-22-33(45-24(3)40)34(46-25(4)41)32(21-43-23(2)39)47-35(22)44-20-29(42)14-13-26-9-11-27(12-10-26)18-37(15-16-38)19-28-17-36-31-8-6-5-7-30(28)31/h5-14,17,22,32-36,38H,15-16,18-21H2,1-4H3/b14-13+/t22-,32-,33-,34+,35-/m1/s1 |
| InChIKey | HESPNLJLIKWXPM-SAYUTFKSSA-N |
| XLogP | 3.55 |
| TPSA | 153.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|