C19H28ClNO — CID 157401014
6-(2,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-3-yl)hexan-1-ol chloride (PubChem CID 157401014) has the molecular formula C19H28ClNO and a molecular weight of 321.89 g/mol. Its IUPAC name is 6-(2,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-3-yl)hexan-1-ol chloride.
| Compound Name | 6-(2,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-3-yl)hexan-1-ol chloride |
|---|---|
| PubChem CID | 157401014 |
| Molecular Formula | C19H28ClNO |
| Molecular Weight | 321.89 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 6-(2,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-3-yl)hexan-1-ol chloride |
| SMILES | CC1=[N+]2CCCc3cccc(c32)C1(C)CCCCCCO.[Cl-] |
| InChI | InChI=1S/C19H28NO.ClH/c1-15-19(2,12-5-3-4-6-14-21)17-11-7-9-16-10-8-13-20(15)18(16)17;/h7,9,11,21H,3-6,8,10,12-14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | MMJZTJLNQXTNAH-UHFFFAOYSA-M |
| XLogP | 0.96 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.89 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|