About tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate
tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate (PubChem CID 157401117) has the molecular formula C27H36N2O5S
and a molecular weight of 500.66 g/mol. Its IUPAC name is tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate |
| PubChem CID | 157401117 |
| Molecular Formula | C27H36N2O5S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate |
| SMILES | CC(C)(C)OC=O.COC(=O)c1sc(-c2ccccc2)cc1N1C(=O)CNC[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C22H26N2O3S.C5H10O2/c1-27-22(26)21-17(12-19(28-21)16-10-6-3-7-11-16)24-18(13-23-14-20(24)25)15-8-4-2-5-9-15;1-5(2,3)7-4-6/h3,6-7,10-12,15,18,23H,2,4-5,8-9,13-14H2,1H3;4H,1-3H3/t18-;/m0./s1 |
| InChIKey | BNEDVNNKBKNOSZ-FERBBOLQSA-N |
| XLogP | 5.04 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate?
The IUPAC name of tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate (CID 157401117) is tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate.
What is the SMILES notation for tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate?
The canonical SMILES for tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate is CC(C)(C)OC=O.COC(=O)c1sc(-c2ccccc2)cc1N1C(=O)CNC[C@H]1C1CCCCC1.
What is the InChIKey of tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate?
The InChIKey is BNEDVNNKBKNOSZ-FERBBOLQSA-N. The full InChI is InChI=1S/C22H26N2O3S.C5H10O2/c1-27-22(26)21-17(12-19(28-21)16-10-6-3-7-11-16)24-18(13-23-14-20(24)25)15-8-4-2-5-9-15;1-5(2,3)7-4-6/h3,6-7,10-12,15,18,23H,2,4-5,8-9,13-14H2,1H3;4H,1-3H3/t18-;/m0./s1.
What are the key properties of tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate?
tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate has a molecular weight of 500.66 g/mol, XLogP of 5.04, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;methyl 3-[(2R)-2-cyclohexyl-6-oxopiperazin-1-yl]-5-phenylthiophene-2-carboxylate is sourced from PubChem (CID 157401117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).