About trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane
trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane (PubChem CID 15740174) has the molecular formula C17H24Si2
and a molecular weight of 284.55 g/mol. Its IUPAC name is trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane.
Molecular Properties
| Compound Name | trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane |
| PubChem CID | 15740174 |
| Molecular Formula | C17H24Si2 |
| Molecular Weight | 284.55 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#CC1=C(C#C[Si](C)(C)C)C2C=CC1C2 |
| InChI | InChI=1S/C17H24Si2/c1-18(2,3)11-9-16-14-7-8-15(13-14)17(16)10-12-19(4,5)6/h7-8,14-15H,13H2,1-6H3 |
| InChIKey | CWVPTALWUWPCJV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane?
The IUPAC name of trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane (CID 15740174) is trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane.
What is the SMILES notation for trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane?
The canonical SMILES for trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane is C[Si](C)(C)C#CC1=C(C#C[Si](C)(C)C)C2C=CC1C2.
What is the InChIKey of trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane?
The InChIKey is CWVPTALWUWPCJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24Si2/c1-18(2,3)11-9-16-14-7-8-15(13-14)17(16)10-12-19(4,5)6/h7-8,14-15H,13H2,1-6H3.
What are the key properties of trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane?
trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane has a molecular weight of 284.55 g/mol, XLogP of 4.25, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[2-[3-(2-trimethylsilylethynyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]ethynyl]silane is sourced from PubChem (CID 15740174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).