C29H30F3NO9S — CID 157401822
3-morpholin-4-ylpropyl 2-hydroxy-4-[[3-(2-hydroxyphenyl)phenyl]sulfonylmethyl]benzoate;2,2,2-trifluoroacetic acid (PubChem CID 157401822) has the molecular formula C29H30F3NO9S and a molecular weight of 625.62 g/mol. Its IUPAC name is 3-morpholin-4-ylpropyl 2-hydroxy-4-[[3-(2-hydroxyphenyl)phenyl]sulfonylmethyl]benzoate;2,2,2-trifluoroacetic acid.
| Compound Name | 3-morpholin-4-ylpropyl 2-hydroxy-4-[[3-(2-hydroxyphenyl)phenyl]sulfonylmethyl]benzoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 157401822 |
| Molecular Formula | C29H30F3NO9S |
| Molecular Weight | 625.62 g/mol |
| Exact Mass | 625.16 |
| IUPAC Name | 3-morpholin-4-ylpropyl 2-hydroxy-4-[[3-(2-hydroxyphenyl)phenyl]sulfonylmethyl]benzoate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(OCCCN1CCOCC1)c1ccc(CS(=O)(=O)c2cccc(-c3ccccc3O)c2)cc1O |
| InChI | InChI=1S/C27H29NO7S.C2HF3O2/c29-25-8-2-1-7-23(25)21-5-3-6-22(18-21)36(32,33)19-20-9-10-24(26(30)17-20)27(31)35-14-4-11-28-12-15-34-16-13-28;3-2(4,5)1(6)7/h1-3,5-10,17-18,29-30H,4,11-16,19H2;(H,6,7) |
| InChIKey | UWKOPAWJNKBHIT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 150.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|