About 2,6-ditert-butylanthracene
2,6-ditert-butylanthracene (PubChem CID 15740416) has the molecular formula C22H26
and a molecular weight of 290.45 g/mol. Its IUPAC name is 2,6-ditert-butylanthracene.
Molecular Properties
| Compound Name | 2,6-ditert-butylanthracene |
| PubChem CID | 15740416 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2,6-ditert-butylanthracene |
| SMILES | CC(C)(C)c1ccc2cc3cc(C(C)(C)C)ccc3cc2c1 |
| InChI | InChI=1S/C22H26/c1-21(2,3)19-9-7-15-12-18-14-20(22(4,5)6)10-8-16(18)11-17(15)13-19/h7-14H,1-6H3 |
| InChIKey | ZNMPPGWFJMSOPK-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,6-ditert-butylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butylanthracene?
The IUPAC name of 2,6-ditert-butylanthracene (CID 15740416) is 2,6-ditert-butylanthracene.
What is the SMILES notation for 2,6-ditert-butylanthracene?
The canonical SMILES for 2,6-ditert-butylanthracene is CC(C)(C)c1ccc2cc3cc(C(C)(C)C)ccc3cc2c1.
What is the InChIKey of 2,6-ditert-butylanthracene?
The InChIKey is ZNMPPGWFJMSOPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26/c1-21(2,3)19-9-7-15-12-18-14-20(22(4,5)6)10-8-16(18)11-17(15)13-19/h7-14H,1-6H3.
What are the key properties of 2,6-ditert-butylanthracene?
2,6-ditert-butylanthracene has a molecular weight of 290.45 g/mol, XLogP of 6.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butylanthracene is sourced from PubChem (CID 15740416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).