C14H10F12O — CID 15740488
2,7-diethyl-3,4,5,6-tetrakis(trifluoromethyl)oxepine (PubChem CID 15740488) has the molecular formula C14H10F12O and a molecular weight of 422.21 g/mol. Its IUPAC name is 2,7-diethyl-3,4,5,6-tetrakis(trifluoromethyl)oxepine.
| Compound Name | 2,7-diethyl-3,4,5,6-tetrakis(trifluoromethyl)oxepine |
|---|---|
| PubChem CID | 15740488 |
| Molecular Formula | C14H10F12O |
| Molecular Weight | 422.21 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 2,7-diethyl-3,4,5,6-tetrakis(trifluoromethyl)oxepine |
| SMILES | CCC1=C(C(F)(F)F)C(C(F)(F)F)=C(C(F)(F)F)C(C(F)(F)F)=C(CC)O1 |
| InChI | InChI=1S/C14H10F12O/c1-3-5-7(11(15,16)17)9(13(21,22)23)10(14(24,25)26)8(12(18,19)20)6(4-2)27-5/h3-4H2,1-2H3 |
| InChIKey | BXOJSOPBJBOUNY-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.21 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |