C27H18Br2ClN7O4 — CID 157405294
6-bromo-4-chloro-3-nitroquinoline;2-[5-[(6-bromo-3-nitroquinolin-4-yl)amino]-2-pyridinyl]-2-methylpropanenitrile (PubChem CID 157405294) has the molecular formula C27H18Br2ClN7O4 and a molecular weight of 699.75 g/mol. Its IUPAC name is 6-bromo-4-chloro-3-nitroquinoline;2-[5-[(6-bromo-3-nitroquinolin-4-yl)amino]-2-pyridinyl]-2-methylpropanenitrile.
| Compound Name | 6-bromo-4-chloro-3-nitroquinoline;2-[5-[(6-bromo-3-nitroquinolin-4-yl)amino]-2-pyridinyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 157405294 |
| Molecular Formula | C27H18Br2ClN7O4 |
| Molecular Weight | 699.75 g/mol |
| Exact Mass | 696.95 |
| IUPAC Name | 6-bromo-4-chloro-3-nitroquinoline;2-[5-[(6-bromo-3-nitroquinolin-4-yl)amino]-2-pyridinyl]-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)c1ccc(Nc2c([N+](=O)[O-])cnc3ccc(Br)cc23)cn1.O=[N+]([O-])c1cnc2ccc(Br)cc2c1Cl |
| InChI | InChI=1S/C18H14BrN5O2.C9H4BrClN2O2/c1-18(2,10-20)16-6-4-12(8-22-16)23-17-13-7-11(19)3-5-14(13)21-9-15(17)24(25)26;10-5-1-2-7-6(3-5)9(11)8(4-12-7)13(14)15/h3-9H,1-2H3,(H,21,23);1-4H |
| InChIKey | BNQMSLXAXTXJNZ-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 160.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.75 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|