About 6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane
6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane (PubChem CID 157405483) has the molecular formula C25H27Br3N6
and a molecular weight of 651.25 g/mol. Its IUPAC name is 6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane.
Molecular Properties
| Compound Name | 6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane |
| PubChem CID | 157405483 |
| Molecular Formula | C25H27Br3N6 |
| Molecular Weight | 651.25 g/mol |
| Exact Mass | 647.98 |
| IUPAC Name | 6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane |
| SMILES | Brc1ccc2cn[nH]c2c1.C.C.Cn1cc2ccc(Br)cc2n1.Cn1ncc2ccc(Br)cc21 |
| InChI | InChI=1S/2C8H7BrN2.C7H5BrN2.2CH4/c1-11-5-6-2-3-7(9)4-8(6)10-11;1-11-8-4-7(9)3-2-6(8)5-10-11;8-6-2-1-5-4-9-10-7(5)3-6;;/h2*2-5H,1H3;1-4H,(H,9,10);2*1H4 |
| InChIKey | BNQZQBYZXCJBJK-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 651.25 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane?
The IUPAC name of 6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane (CID 157405483) is 6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane.
What is the SMILES notation for 6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane?
The canonical SMILES for 6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane is Brc1ccc2cn[nH]c2c1.C.C.Cn1cc2ccc(Br)cc2n1.Cn1ncc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane?
The InChIKey is BNQZQBYZXCJBJK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H7BrN2.C7H5BrN2.2CH4/c1-11-5-6-2-3-7(9)4-8(6)10-11;1-11-8-4-7(9)3-2-6(8)5-10-11;8-6-2-1-5-4-9-10-7(5)3-6;;/h2*2-5H,1H3;1-4H,(H,9,10);2*1H4.
What are the key properties of 6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane?
6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane has a molecular weight of 651.25 g/mol, XLogP of 8.27, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1H-indazole;6-bromo-1-methylindazole;6-bromo-2-methylindazole;methane is sourced from PubChem (CID 157405483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).