C15H17F2NO2 — CID 157405725
(4S,4aS,5S,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-2,5-dimethyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazine (PubChem CID 157405725) has the molecular formula C15H17F2NO2 and a molecular weight of 281.30 g/mol. Its IUPAC name is (4S,4aS,5S,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-2,5-dimethyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazine.
| Compound Name | (4S,4aS,5S,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-2,5-dimethyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazine |
|---|---|
| PubChem CID | 157405725 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (4S,4aS,5S,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-2,5-dimethyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazine |
| SMILES | CC1=N[C@](CF)(c2ccccc2F)[C@H]2[C@H](C)OC[C@H]2O1 |
| InChI | InChI=1S/C15H17F2NO2/c1-9-14-13(7-19-9)20-10(2)18-15(14,8-16)11-5-3-4-6-12(11)17/h3-6,9,13-14H,7-8H2,1-2H3/t9-,13+,14-,15+/m0/s1 |
| InChIKey | BIGHQHHQIQXKOJ-FESTWEEDSA-N |
| XLogP | 2.84 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |