C15H16F2INO2 — CID 157405726
(4S,4aR,5R,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-5-(iodomethyl)-2-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazine (PubChem CID 157405726) has the molecular formula C15H16F2INO2 and a molecular weight of 407.20 g/mol. Its IUPAC name is (4S,4aR,5R,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-5-(iodomethyl)-2-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazine.
| Compound Name | (4S,4aR,5R,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-5-(iodomethyl)-2-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazine |
|---|---|
| PubChem CID | 157405726 |
| Molecular Formula | C15H16F2INO2 |
| Molecular Weight | 407.20 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | (4S,4aR,5R,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-5-(iodomethyl)-2-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazine |
| SMILES | CC1=N[C@](CF)(c2ccccc2F)[C@H]2[C@H](CI)OC[C@H]2O1 |
| InChI | InChI=1S/C15H16F2INO2/c1-9-19-15(8-16,10-4-2-3-5-11(10)17)14-12(6-18)20-7-13(14)21-9/h2-5,12-14H,6-8H2,1H3/t12-,13+,14-,15+/m0/s1 |
| InChIKey | ASKRHESYZSPOMR-LJISPDSOSA-N |
| XLogP | 3.26 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.20 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|