About 6-chloro-2-ethylpyridazin-3-one;ethene
6-chloro-2-ethylpyridazin-3-one;ethene (PubChem CID 157406705) has the molecular formula C8H11ClN2O
and a molecular weight of 186.64 g/mol. Its IUPAC name is 6-chloro-2-ethylpyridazin-3-one;ethene.
Molecular Properties
| Compound Name | 6-chloro-2-ethylpyridazin-3-one;ethene |
| PubChem CID | 157406705 |
| Molecular Formula | C8H11ClN2O |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 6-chloro-2-ethylpyridazin-3-one;ethene |
| SMILES | C=C.CCn1nc(Cl)ccc1=O |
| InChI | InChI=1S/C6H7ClN2O.C2H4/c1-2-9-6(10)4-3-5(7)8-9;1-2/h3-4H,2H2,1H3;1-2H2 |
| InChIKey | BNULFZFZUAISRT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-ethylpyridazin-3-one;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-ethylpyridazin-3-one;ethene?
The IUPAC name of 6-chloro-2-ethylpyridazin-3-one;ethene (CID 157406705) is 6-chloro-2-ethylpyridazin-3-one;ethene.
What is the SMILES notation for 6-chloro-2-ethylpyridazin-3-one;ethene?
The canonical SMILES for 6-chloro-2-ethylpyridazin-3-one;ethene is C=C.CCn1nc(Cl)ccc1=O.
What is the InChIKey of 6-chloro-2-ethylpyridazin-3-one;ethene?
The InChIKey is BNULFZFZUAISRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O.C2H4/c1-2-9-6(10)4-3-5(7)8-9;1-2/h3-4H,2H2,1H3;1-2H2.
What are the key properties of 6-chloro-2-ethylpyridazin-3-one;ethene?
6-chloro-2-ethylpyridazin-3-one;ethene has a molecular weight of 186.64 g/mol, XLogP of 1.72, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-ethylpyridazin-3-one;ethene is sourced from PubChem (CID 157406705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).