C36H38N4O2 — CID 157407280
4-[6-[2-[4-[3-(dimethylamino)propoxy]-3,5-dimethylphenyl]-3H-benzimidazol-5-yl]-3H-indol-2-yl]-2,6-dimethylphenol (PubChem CID 157407280) has the molecular formula C36H38N4O2 and a molecular weight of 558.73 g/mol. Its IUPAC name is 4-[6-[2-[4-[3-(dimethylamino)propoxy]-3,5-dimethylphenyl]-3H-benzimidazol-5-yl]-3H-indol-2-yl]-2,6-dimethylphenol.
| Compound Name | 4-[6-[2-[4-[3-(dimethylamino)propoxy]-3,5-dimethylphenyl]-3H-benzimidazol-5-yl]-3H-indol-2-yl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 157407280 |
| Molecular Formula | C36H38N4O2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | 4-[6-[2-[4-[3-(dimethylamino)propoxy]-3,5-dimethylphenyl]-3H-benzimidazol-5-yl]-3H-indol-2-yl]-2,6-dimethylphenol |
| SMILES | Cc1cc(C2=Nc3cc(-c4ccc5nc(-c6cc(C)c(OCCCN(C)C)c(C)c6)[nH]c5c4)ccc3C2)cc(C)c1O |
| InChI | InChI=1S/C36H38N4O2/c1-21-14-28(15-22(2)34(21)41)32-20-27-9-8-25(18-31(27)37-32)26-10-11-30-33(19-26)39-36(38-30)29-16-23(3)35(24(4)17-29)42-13-7-12-40(5)6/h8-11,14-19,41H,7,12-13,20H2,1-6H3,(H,38,39) |
| InChIKey | BNWGLBRBLUXHMV-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|