C17H16BrN3OS — CID 15740787
3-(4-methoxyphenyl)-10-methyl-2H-[1,3,4]thiadiazino[3,2-a]benzimidazol-10-ium bromide (PubChem CID 15740787) has the molecular formula C17H16BrN3OS and a molecular weight of 390.31 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-10-methyl-2H-[1,3,4]thiadiazino[3,2-a]benzimidazol-10-ium bromide.
| Compound Name | 3-(4-methoxyphenyl)-10-methyl-2H-[1,3,4]thiadiazino[3,2-a]benzimidazol-10-ium bromide |
|---|---|
| PubChem CID | 15740787 |
| Molecular Formula | C17H16BrN3OS |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 3-(4-methoxyphenyl)-10-methyl-2H-[1,3,4]thiadiazino[3,2-a]benzimidazol-10-ium bromide |
| SMILES | COc1ccc(C2=Nn3c([n+](C)c4ccccc43)SC2)cc1.[Br-] |
| InChI | InChI=1S/C17H16N3OS.BrH/c1-19-15-5-3-4-6-16(15)20-17(19)22-11-14(18-20)12-7-9-13(21-2)10-8-12;/h3-10H,11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | IEWUBXKQIFCPGN-UHFFFAOYSA-M |
| XLogP | -0.16 |
| TPSA | 30.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_656c(1)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|