C22H25BrN2O4 — CID 157407969
tert-butyl 5-bromo-1-[2-oxo-3-(1-prop-2-enoylazetidin-3-yl)propyl]indole-3-carboxylate (PubChem CID 157407969) has the molecular formula C22H25BrN2O4 and a molecular weight of 461.36 g/mol. Its IUPAC name is tert-butyl 5-bromo-1-[2-oxo-3-(1-prop-2-enoylazetidin-3-yl)propyl]indole-3-carboxylate.
| Compound Name | tert-butyl 5-bromo-1-[2-oxo-3-(1-prop-2-enoylazetidin-3-yl)propyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 157407969 |
| Molecular Formula | C22H25BrN2O4 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | tert-butyl 5-bromo-1-[2-oxo-3-(1-prop-2-enoylazetidin-3-yl)propyl]indole-3-carboxylate |
| SMILES | C=CC(=O)N1CC(CC(=O)Cn2cc(C(=O)OC(C)(C)C)c3cc(Br)ccc32)C1 |
| InChI | InChI=1S/C22H25BrN2O4/c1-5-20(27)25-10-14(11-25)8-16(26)12-24-13-18(21(28)29-22(2,3)4)17-9-15(23)6-7-19(17)24/h5-7,9,13-14H,1,8,10-12H2,2-4H3 |
| InChIKey | OYCRQCGXDICZGO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|