C22H16ClFN4O2 — CID 157408060
3-[(3-chloro-4-fluorophenyl)methyl]-5-(cyclopropylamino)pyrimido[4,5-c]quinoline-8-carboxylic acid (PubChem CID 157408060) has the molecular formula C22H16ClFN4O2 and a molecular weight of 422.85 g/mol. Its IUPAC name is 3-[(3-chloro-4-fluorophenyl)methyl]-5-(cyclopropylamino)pyrimido[4,5-c]quinoline-8-carboxylic acid.
| Compound Name | 3-[(3-chloro-4-fluorophenyl)methyl]-5-(cyclopropylamino)pyrimido[4,5-c]quinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 157408060 |
| Molecular Formula | C22H16ClFN4O2 |
| Molecular Weight | 422.85 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 3-[(3-chloro-4-fluorophenyl)methyl]-5-(cyclopropylamino)pyrimido[4,5-c]quinoline-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(NC1CC1)c1nc(Cc3ccc(F)c(Cl)c3)ncc12 |
| InChI | InChI=1S/C22H16ClFN4O2/c23-16-7-11(1-6-17(16)24)8-19-25-10-15-14-5-2-12(22(29)30)9-18(14)27-21(20(15)28-19)26-13-3-4-13/h1-2,5-7,9-10,13H,3-4,8H2,(H,26,27)(H,29,30) |
| InChIKey | BNYKSKDKZWJELC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.85 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|