About S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate
S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate (PubChem CID 15740817) has the molecular formula C18H15N3OS
and a molecular weight of 321.41 g/mol. Its IUPAC name is S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate.
Molecular Properties
| Compound Name | S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate |
| PubChem CID | 15740817 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate |
| SMILES | CC(=O)Sc1c(-c2ccccc2)nn2c3ccccc3n(C)c12 |
| InChI | InChI=1S/C18H15N3OS/c1-12(22)23-17-16(13-8-4-3-5-9-13)19-21-15-11-7-6-10-14(15)20(2)18(17)21/h3-11H,1-2H3 |
| InChIKey | LIEJJJKCOPMFSG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate?
The IUPAC name of S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate (CID 15740817) is S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate.
What is the SMILES notation for S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate?
The canonical SMILES for S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate is CC(=O)Sc1c(-c2ccccc2)nn2c3ccccc3n(C)c12.
What is the InChIKey of S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate?
The InChIKey is LIEJJJKCOPMFSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3OS/c1-12(22)23-17-16(13-8-4-3-5-9-13)19-21-15-11-7-6-10-14(15)20(2)18(17)21/h3-11H,1-2H3.
What are the key properties of S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate?
S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate has a molecular weight of 321.41 g/mol, XLogP of 4.13, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methyl-2-phenylpyrazolo[1,5-a]benzimidazol-3-yl) ethanethioate is sourced from PubChem (CID 15740817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).