About 4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate
4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate (PubChem CID 157408266) has the molecular formula C13H22O4S2
and a molecular weight of 306.45 g/mol. Its IUPAC name is 4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate.
Molecular Properties
| Compound Name | 4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate |
| PubChem CID | 157408266 |
| Molecular Formula | C13H22O4S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate |
| SMILES | CCOC(=S)SC(C)(C)C(=O)OCCCC(=O)CC |
| InChI | InChI=1S/C13H22O4S2/c1-5-10(14)8-7-9-17-11(15)13(3,4)19-12(18)16-6-2/h5-9H2,1-4H3 |
| InChIKey | KCXKSPAQCAUXBX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate?
The IUPAC name of 4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate (CID 157408266) is 4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate.
What is the SMILES notation for 4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate?
The canonical SMILES for 4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate is CCOC(=S)SC(C)(C)C(=O)OCCCC(=O)CC.
What is the InChIKey of 4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate?
The InChIKey is KCXKSPAQCAUXBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4S2/c1-5-10(14)8-7-9-17-11(15)13(3,4)19-12(18)16-6-2/h5-9H2,1-4H3.
What are the key properties of 4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate?
4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate has a molecular weight of 306.45 g/mol, XLogP of 3.12, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxohexyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate is sourced from PubChem (CID 157408266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).