C29H37BN2O4 — CID 157409325
tert-butyl (2S)-2-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 157409325) has the molecular formula C29H37BN2O4 and a molecular weight of 488.44 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 157409325 |
| Molecular Formula | C29H37BN2O4 |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | tert-butyl (2S)-2-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=NC=C(c2ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc3c2)C1 |
| InChI | InChI=1S/C29H37BN2O4/c1-27(2,3)34-26(33)32-14-8-9-25(32)24-17-22(18-31-24)20-10-11-21-16-23(13-12-19(21)15-20)30-35-28(4,5)29(6,7)36-30/h10-13,15-16,18,25H,8-9,14,17H2,1-7H3/t25-/m0/s1 |
| InChIKey | HAEQGWHYCQNQNR-VWLOTQADSA-N |
| XLogP | 5.72 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|