C11H12F6O5 — CID 157411429
(3-hydroxy-3-methylpent-4-ynyl) 2,2-difluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)acetate (PubChem CID 157411429) has the molecular formula C11H12F6O5 and a molecular weight of 338.20 g/mol. Its IUPAC name is (3-hydroxy-3-methylpent-4-ynyl) 2,2-difluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)acetate.
| Compound Name | (3-hydroxy-3-methylpent-4-ynyl) 2,2-difluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)acetate |
|---|---|
| PubChem CID | 157411429 |
| Molecular Formula | C11H12F6O5 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (3-hydroxy-3-methylpent-4-ynyl) 2,2-difluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)acetate |
| SMILES | C#CC(C)(O)CCOC(=O)C(F)(F)OC(F)(F)C(F)(F)OC |
| InChI | InChI=1S/C11H12F6O5/c1-4-8(2,19)5-6-21-7(18)9(12,13)22-11(16,17)10(14,15)20-3/h1,19H,5-6H2,2-3H3 |
| InChIKey | NIOFBXYLBMROET-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|