About 1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene
1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene (PubChem CID 157412236) has the molecular formula C13H10F3N3
and a molecular weight of 265.24 g/mol. Its IUPAC name is 1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene.
Molecular Properties
| Compound Name | 1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene |
| PubChem CID | 157412236 |
| Molecular Formula | C13H10F3N3 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene |
| SMILES | FC(F)(F)c1ccccc1.c1cc2[nH]ncc2cn1 |
| InChI | InChI=1S/C7H5F3.C6H5N3/c8-7(9,10)6-4-2-1-3-5-6;1-2-7-3-5-4-8-9-6(1)5/h1-5H;1-4H,(H,8,9) |
| InChIKey | BOKPFWHVDRZDRB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene?
The IUPAC name of 1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene (CID 157412236) is 1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene.
What is the SMILES notation for 1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene?
The canonical SMILES for 1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene is FC(F)(F)c1ccccc1.c1cc2[nH]ncc2cn1.
What is the InChIKey of 1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene?
The InChIKey is BOKPFWHVDRZDRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3.C6H5N3/c8-7(9,10)6-4-2-1-3-5-6;1-2-7-3-5-4-8-9-6(1)5/h1-5H;1-4H,(H,8,9).
What are the key properties of 1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene?
1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene has a molecular weight of 265.24 g/mol, XLogP of 3.66, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazolo[4,5-c]pyridine;trifluoromethylbenzene is sourced from PubChem (CID 157412236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).