C36H38BBrN2O8 — CID 157412662
ethyl 4-bromopyridine-2-carboxylate;ethyl 4-(4-formylphenyl)pyridine-2-carboxylate;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (PubChem CID 157412662) has the molecular formula C36H38BBrN2O8 and a molecular weight of 717.42 g/mol. Its IUPAC name is ethyl 4-bromopyridine-2-carboxylate;ethyl 4-(4-formylphenyl)pyridine-2-carboxylate;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde.
| Compound Name | ethyl 4-bromopyridine-2-carboxylate;ethyl 4-(4-formylphenyl)pyridine-2-carboxylate;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 157412662 |
| Molecular Formula | C36H38BBrN2O8 |
| Molecular Weight | 717.42 g/mol |
| Exact Mass | 716.19 |
| IUPAC Name | ethyl 4-bromopyridine-2-carboxylate;ethyl 4-(4-formylphenyl)pyridine-2-carboxylate;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| SMILES | CC1(C)OB(c2ccc(C=O)cc2)OC1(C)C.CCOC(=O)c1cc(-c2ccc(C=O)cc2)ccn1.CCOC(=O)c1cc(Br)ccn1 |
| InChI | InChI=1S/C15H13NO3.C13H17BO3.C8H8BrNO2/c1-2-19-15(18)14-9-13(7-8-16-14)12-5-3-11(10-17)4-6-12;1-12(2)13(3,4)17-14(16-12)11-7-5-10(9-15)6-8-11;1-2-12-8(11)7-5-6(9)3-4-10-7/h3-10H,2H2,1H3;5-9H,1-4H3;3-5H,2H2,1H3 |
| InChIKey | BOLUBXCDHXAMLY-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 130.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.42 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|