phosphonous acid;phosphorous acid

H6O5P2 — CID 157413046

IUPACphosphonous acid;phosphorous acid
SMILESOP(O)O.OPO
InChIInChI=1S/H3O3P.H3O2P/c1-4(2)3;1-3-2/h1-3H;1-3H
InChIKeyBONASJKBJAQWML-UHFFFAOYSA-N
MW147.99 g/mol
LogP-1.33
Rot. Bonds

About phosphonous acid;phosphorous acid

phosphonous acid;phosphorous acid (PubChem CID 157413046) has the molecular formula H6O5P2 and a molecular weight of 147.99 g/mol. Its IUPAC name is phosphonous acid;phosphorous acid.

Molecular Properties

Compound Namephosphonous acid;phosphorous acid
PubChem CID157413046
Molecular FormulaH6O5P2
Molecular Weight147.99 g/mol
Exact Mass147.97
IUPAC Namephosphonous acid;phosphorous acid
SMILESOP(O)O.OPO
InChIInChI=1S/H3O3P.H3O2P/c1-4(2)3;1-3-2/h1-3H;1-3H
InChIKeyBONASJKBJAQWML-UHFFFAOYSA-N
XLogP-1.33
TPSA101.15 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500147.99
LogP ≤ 5-1.33
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze phosphonous acid;phosphorous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phosphonous acid;phosphorous acid?
The IUPAC name of phosphonous acid;phosphorous acid (CID 157413046) is phosphonous acid;phosphorous acid.
What is the SMILES notation for phosphonous acid;phosphorous acid?
The canonical SMILES for phosphonous acid;phosphorous acid is OP(O)O.OPO.
What is the InChIKey of phosphonous acid;phosphorous acid?
The InChIKey is BONASJKBJAQWML-UHFFFAOYSA-N. The full InChI is InChI=1S/H3O3P.H3O2P/c1-4(2)3;1-3-2/h1-3H;1-3H.
What are the key properties of phosphonous acid;phosphorous acid?
phosphonous acid;phosphorous acid has a molecular weight of 147.99 g/mol, XLogP of -1.33, 0 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phosphonous acid;phosphorous acid is sourced from PubChem (CID 157413046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).