C28H25ClFNO3 — CID 157413134
2-[4-(5-chloro-2-pyridinyl)-2,6-dimethylphenyl]-4-[4-(3-fluorophenyl)-2-oxobutyl]cyclopentane-1,3-dione (PubChem CID 157413134) has the molecular formula C28H25ClFNO3 and a molecular weight of 477.96 g/mol. Its IUPAC name is 2-[4-(5-chloro-2-pyridinyl)-2,6-dimethylphenyl]-4-[4-(3-fluorophenyl)-2-oxobutyl]cyclopentane-1,3-dione.
| Compound Name | 2-[4-(5-chloro-2-pyridinyl)-2,6-dimethylphenyl]-4-[4-(3-fluorophenyl)-2-oxobutyl]cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 157413134 |
| Molecular Formula | C28H25ClFNO3 |
| Molecular Weight | 477.96 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-[4-(5-chloro-2-pyridinyl)-2,6-dimethylphenyl]-4-[4-(3-fluorophenyl)-2-oxobutyl]cyclopentane-1,3-dione |
| SMILES | Cc1cc(-c2ccc(Cl)cn2)cc(C)c1C1C(=O)CC(CC(=O)CCc2cccc(F)c2)C1=O |
| InChI | InChI=1S/C28H25ClFNO3/c1-16-10-19(24-9-7-21(29)15-31-24)11-17(2)26(16)27-25(33)14-20(28(27)34)13-23(32)8-6-18-4-3-5-22(30)12-18/h3-5,7,9-12,15,20,27H,6,8,13-14H2,1-2H3 |
| InChIKey | BONHHPWQEIKQGG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.96 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|