C21H14Cl3N9O6 — CID 157413396
5-chloro-2-[(5-chloro-4-nitro-1H-benzimidazol-2-yl)methyl]-4-nitro-1H-benzimidazole;4-chloro-3-nitrobenzene-1,2-diamine (PubChem CID 157413396) has the molecular formula C21H14Cl3N9O6 and a molecular weight of 594.76 g/mol. Its IUPAC name is 5-chloro-2-[(5-chloro-4-nitro-1H-benzimidazol-2-yl)methyl]-4-nitro-1H-benzimidazole;4-chloro-3-nitrobenzene-1,2-diamine.
| Compound Name | 5-chloro-2-[(5-chloro-4-nitro-1H-benzimidazol-2-yl)methyl]-4-nitro-1H-benzimidazole;4-chloro-3-nitrobenzene-1,2-diamine |
|---|---|
| PubChem CID | 157413396 |
| Molecular Formula | C21H14Cl3N9O6 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 593.01 |
| IUPAC Name | 5-chloro-2-[(5-chloro-4-nitro-1H-benzimidazol-2-yl)methyl]-4-nitro-1H-benzimidazole;4-chloro-3-nitrobenzene-1,2-diamine |
| SMILES | Nc1ccc(Cl)c([N+](=O)[O-])c1N.O=[N+]([O-])c1c(Cl)ccc2[nH]c(Cc3nc4c([N+](=O)[O-])c(Cl)ccc4[nH]3)nc12 |
| InChI | InChI=1S/C15H8Cl2N6O4.C6H6ClN3O2/c16-6-1-3-8-12(14(6)22(24)25)20-10(18-8)5-11-19-9-4-2-7(17)15(23(26)27)13(9)21-11;7-3-1-2-4(8)5(9)6(3)10(11)12/h1-4H,5H2,(H,18,20)(H,19,21);1-2H,8-9H2 |
| InChIKey | BOOAZWIDPAHRBP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 238.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|