About 2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one
2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one (PubChem CID 157413658) has the molecular formula C23H21BrO3
and a molecular weight of 425.32 g/mol. Its IUPAC name is 2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one.
Molecular Properties
| Compound Name | 2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one |
| PubChem CID | 157413658 |
| Molecular Formula | C23H21BrO3 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one |
| SMILES | CC1(C)C2=C(C(=O)c3ccc(O[C@@H]4CCOC4)cc31)c1ccc(Br)cc1C2 |
| InChI | InChI=1S/C23H21BrO3/c1-23(2)19-11-15(27-16-7-8-26-12-16)4-6-18(19)22(25)21-17-5-3-14(24)9-13(17)10-20(21)23/h3-6,9,11,16H,7-8,10,12H2,1-2H3/t16-/m1/s1 |
| InChIKey | BOOWIINFCFJIBI-MRXNPFEDSA-N |
| XLogP | 5.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one?
The IUPAC name of 2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one (CID 157413658) is 2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one.
What is the SMILES notation for 2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one?
The canonical SMILES for 2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one is CC1(C)C2=C(C(=O)c3ccc(O[C@@H]4CCOC4)cc31)c1ccc(Br)cc1C2.
What is the InChIKey of 2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one?
The InChIKey is BOOWIINFCFJIBI-MRXNPFEDSA-N. The full InChI is InChI=1S/C23H21BrO3/c1-23(2)19-11-15(27-16-7-8-26-12-16)4-6-18(19)22(25)21-17-5-3-14(24)9-13(17)10-20(21)23/h3-6,9,11,16H,7-8,10,12H2,1-2H3/t16-/m1/s1.
What are the key properties of 2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one?
2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one has a molecular weight of 425.32 g/mol, XLogP of 5.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-10,10-dimethyl-8-[(3R)-oxolan-3-yl]oxy-11H-benzo[b]fluoren-5-one is sourced from PubChem (CID 157413658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).