C9H9F7O2 — CID 157414129
5-(2,2,3,3,4,4,4-heptafluorobutoxy)pent-1-en-3-one (PubChem CID 157414129) has the molecular formula C9H9F7O2 and a molecular weight of 282.15 g/mol. Its IUPAC name is 5-(2,2,3,3,4,4,4-heptafluorobutoxy)pent-1-en-3-one.
| Compound Name | 5-(2,2,3,3,4,4,4-heptafluorobutoxy)pent-1-en-3-one |
|---|---|
| PubChem CID | 157414129 |
| Molecular Formula | C9H9F7O2 |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 5-(2,2,3,3,4,4,4-heptafluorobutoxy)pent-1-en-3-one |
| SMILES | C=CC(=O)CCOCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F7O2/c1-2-6(17)3-4-18-5-7(10,11)8(12,13)9(14,15)16/h2H,1,3-5H2 |
| InChIKey | BOQGPCJETLHNPI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|