C32H31Cl3N6O4 — CID 157414522
2-chloro-N-(4-morpholin-2-ylphenyl)pyridine-4-carboxamide;5,6-dichloro-N-(4-morpholin-2-ylphenyl)pyridine-3-carboxamide (PubChem CID 157414522) has the molecular formula C32H31Cl3N6O4 and a molecular weight of 670.00 g/mol. Its IUPAC name is 2-chloro-N-(4-morpholin-2-ylphenyl)pyridine-4-carboxamide;5,6-dichloro-N-(4-morpholin-2-ylphenyl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(4-morpholin-2-ylphenyl)pyridine-4-carboxamide;5,6-dichloro-N-(4-morpholin-2-ylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 157414522 |
| Molecular Formula | C32H31Cl3N6O4 |
| Molecular Weight | 670.00 g/mol |
| Exact Mass | 668.15 |
| IUPAC Name | 2-chloro-N-(4-morpholin-2-ylphenyl)pyridine-4-carboxamide;5,6-dichloro-N-(4-morpholin-2-ylphenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C2CNCCO2)cc1)c1ccnc(Cl)c1.O=C(Nc1ccc(C2CNCCO2)cc1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2N3O2.C16H16ClN3O2/c17-13-7-11(8-20-15(13)18)16(22)21-12-3-1-10(2-4-12)14-9-19-5-6-23-14;17-15-9-12(5-6-19-15)16(21)20-13-3-1-11(2-4-13)14-10-18-7-8-22-14/h1-4,7-8,14,19H,5-6,9H2,(H,21,22);1-6,9,14,18H,7-8,10H2,(H,20,21) |
| InChIKey | BORKOGQMWGXZQI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.00 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|