About N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride
N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride (PubChem CID 157414571) has the molecular formula C4H9Cl3N2O5S2
and a molecular weight of 335.62 g/mol. Its IUPAC name is N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride.
Molecular Properties
| Compound Name | N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride |
| PubChem CID | 157414571 |
| Molecular Formula | C4H9Cl3N2O5S2 |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 333.90 |
| IUPAC Name | N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride |
| SMILES | O=S(=O)(Cl)Cl.O=S(=O)(Cl)NN1CCOCC1 |
| InChI | InChI=1S/C4H9ClN2O3S.Cl2O2S/c5-11(8,9)6-7-1-3-10-4-2-7;1-5(2,3)4/h6H,1-4H2; |
| InChIKey | BORNXJCEFIIIPK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride?
The IUPAC name of N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride (CID 157414571) is N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride.
What is the SMILES notation for N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride?
The canonical SMILES for N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride is O=S(=O)(Cl)Cl.O=S(=O)(Cl)NN1CCOCC1.
What is the InChIKey of N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride?
The InChIKey is BORNXJCEFIIIPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9ClN2O3S.Cl2O2S/c5-11(8,9)6-7-1-3-10-4-2-7;1-5(2,3)4/h6H,1-4H2;.
What are the key properties of N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride?
N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride has a molecular weight of 335.62 g/mol, XLogP of 0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-morpholin-4-ylsulfamoyl chloride;sulfuryl dichloride is sourced from PubChem (CID 157414571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).