C26H37F3N2O — CID 157415227
(3R,5R,8R,9R,10S,13S,14S,17S)-3,13-dimethyl-17-[3-[3-(trifluoromethyl)pyrazol-1-yl]prop-1-en-2-yl]-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 157415227) has the molecular formula C26H37F3N2O and a molecular weight of 450.59 g/mol. Its IUPAC name is (3R,5R,8R,9R,10S,13S,14S,17S)-3,13-dimethyl-17-[3-[3-(trifluoromethyl)pyrazol-1-yl]prop-1-en-2-yl]-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5R,8R,9R,10S,13S,14S,17S)-3,13-dimethyl-17-[3-[3-(trifluoromethyl)pyrazol-1-yl]prop-1-en-2-yl]-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 157415227 |
| Molecular Formula | C26H37F3N2O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | (3R,5R,8R,9R,10S,13S,14S,17S)-3,13-dimethyl-17-[3-[3-(trifluoromethyl)pyrazol-1-yl]prop-1-en-2-yl]-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=C(Cn1ccc(C(F)(F)F)n1)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@](C)(O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H37F3N2O/c1-16(15-31-13-10-23(30-31)26(27,28)29)21-6-7-22-20-5-4-17-14-24(2,32)11-8-18(17)19(20)9-12-25(21,22)3/h10,13,17-22,32H,1,4-9,11-12,14-15H2,2-3H3/t17-,18+,19-,20-,21-,22+,24-,25-/m1/s1 |
| InChIKey | OUGITNJELRGQEV-JFNOBYMHSA-N |
| XLogP | 6.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|