C38H40O6 — CID 157416908
2-[(26,27,28-trihydroxy-5,11,17,23-tetramethyl-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)oxy]ethyl 2-methylprop-2-enoate (PubChem CID 157416908) has the molecular formula C38H40O6 and a molecular weight of 592.73 g/mol. Its IUPAC name is 2-[(26,27,28-trihydroxy-5,11,17,23-tetramethyl-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)oxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(26,27,28-trihydroxy-5,11,17,23-tetramethyl-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)oxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 157416908 |
| Molecular Formula | C38H40O6 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 2-[(26,27,28-trihydroxy-5,11,17,23-tetramethyl-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)oxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1c2cc(C)cc1Cc1cc(C)cc(c1O)Cc1cc(C)cc(c1O)Cc1cc(C)cc(c1O)C2 |
| InChI | InChI=1S/C38H40O6/c1-21(2)38(42)44-8-7-43-37-32-15-25(6)16-33(37)20-31-14-24(5)12-29(36(31)41)18-27-10-22(3)9-26(34(27)39)17-28-11-23(4)13-30(19-32)35(28)40/h9-16,39-41H,1,7-8,17-20H2,2-6H3 |
| InChIKey | DLEBPPLELRVHFN-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|