About 3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine
3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine (PubChem CID 157419162) has the molecular formula C16H19I2NO
and a molecular weight of 495.14 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine |
| PubChem CID | 157419162 |
| Molecular Formula | C16H19I2NO |
| Molecular Weight | 495.14 g/mol |
| Exact Mass | 494.96 |
| IUPAC Name | 3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine |
| SMILES | Cc1ccc(CC2(C#N)CCC(C)(C)C2=O)cc1.II |
| InChI | InChI=1S/C16H19NO.I2/c1-12-4-6-13(7-5-12)10-16(11-17)9-8-15(2,3)14(16)18;1-2/h4-7H,8-10H2,1-3H3; |
| InChIKey | BPEXTVYZUZPULN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.14 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine?
The IUPAC name of 3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine (CID 157419162) is 3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine.
What is the SMILES notation for 3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine?
The canonical SMILES for 3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine is Cc1ccc(CC2(C#N)CCC(C)(C)C2=O)cc1.II.
What is the InChIKey of 3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine?
The InChIKey is BPEXTVYZUZPULN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO.I2/c1-12-4-6-13(7-5-12)10-16(11-17)9-8-15(2,3)14(16)18;1-2/h4-7H,8-10H2,1-3H3;.
What are the key properties of 3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine?
3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine has a molecular weight of 495.14 g/mol, XLogP of 5.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-[(4-methylphenyl)methyl]-2-oxocyclopentane-1-carbonitrile;molecular iodine is sourced from PubChem (CID 157419162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).