C12H15F3N2O2S — CID 157420942
4-methyl-N-[3-[(E)-3,3,3-trifluoroprop-1-enyl]sulfonylpropyl]pyridin-2-amine (PubChem CID 157420942) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.33 g/mol. Its IUPAC name is 4-methyl-N-[3-[(E)-3,3,3-trifluoroprop-1-enyl]sulfonylpropyl]pyridin-2-amine.
| Compound Name | 4-methyl-N-[3-[(E)-3,3,3-trifluoroprop-1-enyl]sulfonylpropyl]pyridin-2-amine |
|---|---|
| PubChem CID | 157420942 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-methyl-N-[3-[(E)-3,3,3-trifluoroprop-1-enyl]sulfonylpropyl]pyridin-2-amine |
| SMILES | Cc1ccnc(NCCCS(=O)(=O)/C=C/C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O2S/c1-10-3-6-17-11(9-10)16-5-2-7-20(18,19)8-4-12(13,14)15/h3-4,6,8-9H,2,5,7H2,1H3,(H,16,17)/b8-4+ |
| InChIKey | BPJYHAIEDGREKJ-XBXARRHUSA-N |
| XLogP | 2.68 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|