About methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate
methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate (PubChem CID 157421302) has the molecular formula C8H20ClO8S2+
and a molecular weight of 343.83 g/mol. Its IUPAC name is methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate.
Molecular Properties
| Compound Name | methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate |
| PubChem CID | 157421302 |
| Molecular Formula | C8H20ClO8S2+ |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate |
| SMILES | COCCO.COCCOS(C)(=O)=O.[CH2+]S(=O)(=O)Cl |
| InChI | InChI=1S/C4H10O4S.C3H8O2.CH2ClO2S/c1-7-3-4-8-9(2,5)6;1-5-3-2-4;1-5(2,3)4/h3-4H2,1-2H3;4H,2-3H2,1H3;1H2/q;;+1 |
| InChIKey | BPLAJNRWJSKAEB-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate?
The IUPAC name of methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate (CID 157421302) is methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate.
What is the SMILES notation for methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate?
The canonical SMILES for methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate is COCCO.COCCOS(C)(=O)=O.[CH2+]S(=O)(=O)Cl.
What is the InChIKey of methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate?
The InChIKey is BPLAJNRWJSKAEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O4S.C3H8O2.CH2ClO2S/c1-7-3-4-8-9(2,5)6;1-5-3-2-4;1-5(2,3)4/h3-4H2,1-2H3;4H,2-3H2,1H3;1H2/q;;+1.
What are the key properties of methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate?
methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate has a molecular weight of 343.83 g/mol, XLogP of -0.42, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonyl chloride;2-methoxyethanol;2-methoxyethyl methanesulfonate is sourced from PubChem (CID 157421302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).