C24H34O3 — CID 157421661
2-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-6-ethoxy-3-hydroxy-4-methylidenecyclohexa-2,5-dien-1-one (PubChem CID 157421661) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is 2-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-6-ethoxy-3-hydroxy-4-methylidenecyclohexa-2,5-dien-1-one.
| Compound Name | 2-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-6-ethoxy-3-hydroxy-4-methylidenecyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 157421661 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 2-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-6-ethoxy-3-hydroxy-4-methylidenecyclohexa-2,5-dien-1-one |
| SMILES | C=C1C=C(OCC)C(=O)C(CC2(C)C(C)CCC3(C)C(=C)CCCC32)=C1O |
| InChI | InChI=1S/C24H34O3/c1-7-27-19-13-15(2)21(25)18(22(19)26)14-24(6)17(4)11-12-23(5)16(3)9-8-10-20(23)24/h13,17,20,25H,2-3,7-12,14H2,1,4-6H3 |
| InChIKey | NBVBUUOLYJRABT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|