C22H42N4O3Si — CID 157423335
4-[2-amino-6-[[(3S)-1-[tert-butyl(dimethyl)silyl]oxyheptan-3-yl]amino]-5-methoxypyrimidin-4-yl]butan-2-one (PubChem CID 157423335) has the molecular formula C22H42N4O3Si and a molecular weight of 438.69 g/mol. Its IUPAC name is 4-[2-amino-6-[[(3S)-1-[tert-butyl(dimethyl)silyl]oxyheptan-3-yl]amino]-5-methoxypyrimidin-4-yl]butan-2-one.
| Compound Name | 4-[2-amino-6-[[(3S)-1-[tert-butyl(dimethyl)silyl]oxyheptan-3-yl]amino]-5-methoxypyrimidin-4-yl]butan-2-one |
|---|---|
| PubChem CID | 157423335 |
| Molecular Formula | C22H42N4O3Si |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 4-[2-amino-6-[[(3S)-1-[tert-butyl(dimethyl)silyl]oxyheptan-3-yl]amino]-5-methoxypyrimidin-4-yl]butan-2-one |
| SMILES | CCCC[C@@H](CCO[Si](C)(C)C(C)(C)C)Nc1nc(N)nc(CCC(C)=O)c1OC |
| InChI | InChI=1S/C22H42N4O3Si/c1-9-10-11-17(14-15-29-30(7,8)22(3,4)5)24-20-19(28-6)18(13-12-16(2)27)25-21(23)26-20/h17H,9-15H2,1-8H3,(H3,23,24,25,26)/t17-/m0/s1 |
| InChIKey | LRQDDZXQIJCJAX-KRWDZBQOSA-N |
| XLogP | 4.97 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|